| Name | Praseodymium acetate |
| Synonyms | Praseodymium acetate praseodymium triacetate salt praseodymium acetate acetic acid, praseodymium aceticacid,praseodymium(3++)salt Acetic acid, praseodymium(3+) salt Praseodymium(Iii) Acetate Hydrate (Reo) 6-ethyl-2,3-bis(propan-2-yloxy)-6H-indolo[2,3-b]quinoxaline |
| CAS | 6192-12-7 |
| EINECS | 228-242-4 |
| InChI | InChI=1/C22H25N3O2/c1-6-25-18-10-8-7-9-15(18)21-22(25)24-17-12-20(27-14(4)5)19(26-13(2)3)11-16(17)23-21/h7-14H,6H2,1-5H3 |
| Molecular Formula | C5H12O2 |
| Molar Mass | 104.15 |
| Density | 1.2g/cm3 |
| Boling Point | 536.2°C at 760 mmHg |
| Flash Point | 278.1°C |
| Vapor Presure | 1.43E-11mmHg at 25°C |
| Appearance | crystal |
| Color | green |
| Storage Condition | Room Temprature |
| Stability | hygroscopic |
| Sensitive | 0: forms stable aqueous solutions |
| Refractive Index | 1.618 |
| MDL | MFCD00150121 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| TSCA | Yes |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | research reagents, biochemical research |